What is the structure of 4 methyl pentane 2?
4-Methyl-2-pentene
| PubChem CID | 12659 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H12 |
| Synonyms | 4-Methylpent-2-ene 4-METHYL-2-PENTENE 2-Pentene, 4-methyl-, (2Z)- 4461-48-7 isopropyl propene More… |
What is the structure of 4 methyl 2 hexene?
4-Methyl-2-hexene | C7H14 – PubChem.
What is the structure of 4 methyl 2 hexanol?
Compound with free spectra: 4 MS
| SpectraBase Compound ID | 7sgPQP55BzM |
|---|---|
| InChI | InChI=1S/C7H16O/c1-4-6(2)5-7(3)8/h6-8H,4-5H2,1-3H3 |
| InChIKey | KZUBXUKRWLMPIO-UHFFFAOYSA-N |
| Mol Weight | 116.2 g/mol |
| Molecular Formula | C7H16O |
What is the correct structure of 4 methyl 2 hexanone?
4-Methyl-2-hexanone | C7H14O – PubChem.
What is the structure of 4 methyl pentane?
4-Methylpentane-1,4-diol | C6H14O2 – PubChem.
What is the structure of 4 methyl?
4-methylheptane is a branched C8 alkane, comprising heptane with a methyl group attached at C-4. It has been found in Amaranth seeds. It has a role as a plant metabolite.
What is the correct name of 2 Methyl 4 hexene?
2-Methyl-4-hexen-3-one
| PubChem CID | 12809163 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C7H12O |
| Synonyms | 2-Methyl-4-hexen-3-one 2-methyl-hex-4-en-3-one SCHEMBL410195 (E)-2-Methyl-4-hexen-3-one trans-2-methyl-hex-4-en-3-one |
| Molecular Weight | 112.17 |
What is the structural formula of 2 Methyl 2 hexene?
C7H14
2-Methyl-2-hexene 97.0+%, TCI America
| CAS | 2738-19-4 |
|---|---|
| Molecular Formula | C7H14 |
| Molecular Weight (g/mol) | 98.189 |
| MDL Number | MFCD00027232 |
| InChI Key | BWEKDYGHDCHWEN-UHFFFAOYSA-N |
What is the molecular formula for methyl alcohol?
CH3OHMethanol / Formula
Is 3 hexanol soluble in water?
3-Hexanol
| Names | |
|---|---|
| Boiling point | 135 °C (275 °F; 408 K) |
| Solubility in water | 16 g/L |
| Solubility | miscible with diethyl ether; very soluble in ethanol, acetone |
| Thermochemistry |
What is the structural formula for 2 2 dimethylpropane?
C5H12Neopentane / Formula